C7H14N2O2 — CID 121419738
3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5,6-diamine (PubChem CID 121419738) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5,6-diamine.
| Compound Name | 3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5,6-diamine |
|---|---|
| PubChem CID | 121419738 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5,6-diamine |
| SMILES | NC1CC2OCOC2CC1N |
| InChI | InChI=1S/C7H14N2O2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h4-7H,1-3,8-9H2 |
| InChIKey | AUXJCXKDYFGZMS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |