C12H6F8 — CID 121476187
5,5,6,6-tetrafluoro-1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 121476187) has the molecular formula C12H6F8 and a molecular weight of 302.16 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476187 |
| Molecular Formula | C12H6F8 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | FC1(F)C=CC=C(C2=CC=CC(F)(F)C2(F)F)C1(F)F |
| InChI | InChI=1S/C12H6F8/c13-9(14)5-1-3-7(11(9,17)18)8-4-2-6-10(15,16)12(8,19)20/h1-6H |
| InChIKey | AWLJSTISWNVWKA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|