C26H40F4O2 — CID 121476292
2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-pentylcyclohexyl)oxane (PubChem CID 121476292) has the molecular formula C26H40F4O2 and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-pentylcyclohexyl)oxane.
| Compound Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-pentylcyclohexyl)oxane |
|---|---|
| PubChem CID | 121476292 |
| Molecular Formula | C26H40F4O2 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-pentylcyclohexyl)oxane |
| SMILES | CCCCCC1CCC(C2CCC(CCC3=CC=C(OCC)C(F)(F)C3(F)F)OC2)CC1 |
| InChI | InChI=1S/C26H40F4O2/c1-3-5-6-7-19-8-10-20(11-9-19)21-12-15-23(32-18-21)16-13-22-14-17-24(31-4-2)26(29,30)25(22,27)28/h14,17,19-21,23H,3-13,15-16,18H2,1-2H3 |
| InChIKey | VHGQVIKNDRENMS-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|