C18H15N5 — CID 1219414
(1R,2S,8aS)-3-amino-2-pyridin-3-yl-6,7,8,8a-tetrahydro-1H-naphthalene-1,2,4-tricarbonitrile (PubChem CID 1219414) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is (1R,2S,8aS)-3-amino-2-pyridin-3-yl-6,7,8,8a-tetrahydro-1H-naphthalene-1,2,4-tricarbonitrile.
| Compound Name | (1R,2S,8aS)-3-amino-2-pyridin-3-yl-6,7,8,8a-tetrahydro-1H-naphthalene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 1219414 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1R,2S,8aS)-3-amino-2-pyridin-3-yl-6,7,8,8a-tetrahydro-1H-naphthalene-1,2,4-tricarbonitrile |
| SMILES | N#CC1=C(N)[C@@](C#N)(c2cccnc2)[C@H](C#N)[C@@H]2CCCC=C12 |
| InChI | InChI=1S/C18H15N5/c19-8-15-13-5-1-2-6-14(13)16(9-20)18(11-21,17(15)22)12-4-3-7-23-10-12/h3-5,7,10,14,16H,1-2,6,22H2/t14-,16-,18+/m1/s1 |
| InChIKey | FTMSZMYDZCTLFS-KYJSFNMBSA-N |
| XLogP | 2.46 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |