C16H23ClFNO2 — CID 122128487
2-[[3-(2-chloro-6-fluorophenyl)propylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122128487) has the molecular formula C16H23ClFNO2 and a molecular weight of 315.82 g/mol. Its IUPAC name is 2-[[3-(2-chloro-6-fluorophenyl)propylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[3-(2-chloro-6-fluorophenyl)propylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122128487 |
| Molecular Formula | C16H23ClFNO2 |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[[3-(2-chloro-6-fluorophenyl)propylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCCCc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C16H23ClFNO2/c1-3-16(4-2,15(20)21)11-19-10-6-7-12-13(17)8-5-9-14(12)18/h5,8-9,19H,3-4,6-7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | VMKXWWIIOSEXCW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|