C25H24F3N5O12P2 — CID 122183335
[4-[[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 122183335) has the molecular formula C25H24F3N5O12P2 and a molecular weight of 705.43 g/mol. Its IUPAC name is [4-[[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]phenyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]phenyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 122183335 |
| Molecular Formula | C25H24F3N5O12P2 |
| Molecular Weight | 705.43 g/mol |
| Exact Mass | 705.08 |
| IUPAC Name | [4-[[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(O)OP(=O)(O)OCc3ccc(OC(=O)c4ccc(C(F)(F)F)cc4)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H24F3N5O12P2/c1-14-11-33(24(36)30-22(14)34)21-10-19(31-32-29)20(44-21)13-42-47(39,40)45-46(37,38)41-12-15-2-8-18(9-3-15)43-23(35)16-4-6-17(7-5-16)25(26,27)28/h2-9,11,19-21H,10,12-13H2,1H3,(H,37,38)(H,39,40)(H,30,34,36)/t19-,20+,21+/m0/s1 |
| InChIKey | HEGZMKBVEGPXHY-PWRODBHTSA-N |
| XLogP | 4.50 |
| TPSA | 241.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|