C30H50N4O7S — CID 122193364
S-[(E)-4-[(6R,9R,12R,16S)-9-methyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] octanethioate (PubChem CID 122193364) has the molecular formula C30H50N4O7S and a molecular weight of 610.82 g/mol. Its IUPAC name is S-[(E)-4-[(6R,9R,12R,16S)-9-methyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(6R,9R,12R,16S)-9-methyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 122193364 |
| Molecular Formula | C30H50N4O7S |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | S-[(E)-4-[(6R,9R,12R,16S)-9-methyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)N[C@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)O1 |
| InChI | InChI=1S/C30H50N4O7S/c1-7-8-9-10-11-15-25(37)42-16-13-12-14-22-17-23(35)33-27(20(4)5)30(40)32-21(6)28(38)34-26(19(2)3)29(39)31-18-24(36)41-22/h12,14,19-22,26-27H,7-11,13,15-18H2,1-6H3,(H,31,39)(H,32,40)(H,33,35)(H,34,38)/b14-12+/t21-,22-,26-,27-/m1/s1 |
| InChIKey | XNAZTHURLSEPRP-HXWVIUDNSA-N |
| XLogP | 2.77 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|