C27H22N2O6S — CID 122195326
2-[4-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxybutylamino]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 122195326) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-[4-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxybutylamino]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[4-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxybutylamino]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 122195326 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-[4-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxybutylamino]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1 |
| InChI | InChI=1S/C27H22N2O6S/c30-20-13-18(14-23-25(20)21(31)15-22(35-23)16-6-2-1-3-7-16)34-11-5-4-10-28-27-29-19-9-8-17(26(32)33)12-24(19)36-27/h1-3,6-9,12-15,30H,4-5,10-11H2,(H,28,29)(H,32,33) |
| InChIKey | IHYPYGQLWRZCEJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|