C30H28N2O5S — CID 122195329
7-[4-[(6-butanoyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 122195329) has the molecular formula C30H28N2O5S and a molecular weight of 528.63 g/mol. Its IUPAC name is 7-[4-[(6-butanoyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 7-[4-[(6-butanoyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 122195329 |
| Molecular Formula | C30H28N2O5S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 7-[4-[(6-butanoyl-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | CCCC(=O)c1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1 |
| InChI | InChI=1S/C30H28N2O5S/c1-2-8-23(33)20-11-12-22-28(15-20)38-30(32-22)31-13-6-7-14-36-21-16-24(34)29-25(35)18-26(37-27(29)17-21)19-9-4-3-5-10-19/h3-5,9-12,15-18,34H,2,6-8,13-14H2,1H3,(H,31,32) |
| InChIKey | KZLLLPMXGBABTJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|