C16H19NO — CID 122207280
3a-pentyl-1H-pyrrolo[1,2-a]indol-4-one (PubChem CID 122207280) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 3a-pentyl-1H-pyrrolo[1,2-a]indol-4-one.
| Compound Name | 3a-pentyl-1H-pyrrolo[1,2-a]indol-4-one |
|---|---|
| PubChem CID | 122207280 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3a-pentyl-1H-pyrrolo[1,2-a]indol-4-one |
| SMILES | CCCCCC12C=CCN1c1ccccc1C2=O |
| InChI | InChI=1S/C16H19NO/c1-2-3-6-10-16-11-7-12-17(16)14-9-5-4-8-13(14)15(16)18/h4-5,7-9,11H,2-3,6,10,12H2,1H3 |
| InChIKey | QJAXUXOOHLFRDR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|