C20H27N3O12 — CID 122216559
[2-acetyloxy-3-[3-(2,3-diacetyloxypropyl)-5-(oxiran-2-ylmethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] acetate (PubChem CID 122216559) has the molecular formula C20H27N3O12 and a molecular weight of 501.45 g/mol. Its IUPAC name is [2-acetyloxy-3-[3-(2,3-diacetyloxypropyl)-5-(oxiran-2-ylmethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] acetate.
| Compound Name | [2-acetyloxy-3-[3-(2,3-diacetyloxypropyl)-5-(oxiran-2-ylmethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] acetate |
|---|---|
| PubChem CID | 122216559 |
| Molecular Formula | C20H27N3O12 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [2-acetyloxy-3-[3-(2,3-diacetyloxypropyl)-5-(oxiran-2-ylmethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl] acetate |
| SMILES | CC(=O)OCC(Cn1c(=O)n(CC2CO2)c(=O)n(CC(COC(C)=O)OC(C)=O)c1=O)OC(C)=O |
| InChI | InChI=1S/C20H27N3O12/c1-11(24)31-9-16(34-13(3)26)6-22-18(28)21(5-15-8-33-15)19(29)23(20(22)30)7-17(35-14(4)27)10-32-12(2)25/h15-17H,5-10H2,1-4H3 |
| InChIKey | PQCBABKBQSBMAP-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 183.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|