C14H23N3O8 — CID 138624890
1,3-bis(ethoxymethoxymethyl)-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 138624890) has the molecular formula C14H23N3O8 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1,3-bis(ethoxymethoxymethyl)-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(ethoxymethoxymethyl)-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138624890 |
| Molecular Formula | C14H23N3O8 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1,3-bis(ethoxymethoxymethyl)-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCOCOCn1c(=O)n(COCOCC)c(=O)n(CC2CO2)c1=O |
| InChI | InChI=1S/C14H23N3O8/c1-3-21-9-23-7-16-12(18)15(5-11-6-25-11)13(19)17(14(16)20)8-24-10-22-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | SOMAQOGNZMSFGA-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 115.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|