C16H22O3 — CID 122218293
(1R,3S,6R,9S)-9-[[(1R)-cyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one (PubChem CID 122218293) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,3S,6R,9S)-9-[[(1R)-cyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one.
| Compound Name | (1R,3S,6R,9S)-9-[[(1R)-cyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
|---|---|
| PubChem CID | 122218293 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1R,3S,6R,9S)-9-[[(1R)-cyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
| SMILES | C[C@]12CC[C@@H]3C[C@H](C(=O)O1)[C@@]32OC[C@H]1C=CCCC1 |
| InChI | InChI=1S/C16H22O3/c1-15-8-7-12-9-13(14(17)19-15)16(12,15)18-10-11-5-3-2-4-6-11/h3,5,11-13H,2,4,6-10H2,1H3/t11-,12+,13+,15+,16-/m0/s1 |
| InChIKey | RDXCKJNUKJGVCS-HGYYMRRCSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|