C14H22N8O4 — CID 122218600
2-azidoethyl N-[6-[(6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]carbamate (PubChem CID 122218600) has the molecular formula C14H22N8O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-azidoethyl N-[6-[(6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]carbamate.
| Compound Name | 2-azidoethyl N-[6-[(6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 122218600 |
| Molecular Formula | C14H22N8O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-azidoethyl N-[6-[(6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]carbamate |
| SMILES | [N-]=[N+]=NCCOC(=O)NCCCCCCNC(=O)Nc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C14H22N8O4/c15-22-19-9-10-26-14(25)18-7-4-2-1-3-6-17-13(24)21-12-16-8-5-11(23)20-12/h5,8H,1-4,6-7,9-10H2,(H,18,25)(H3,16,17,20,21,23,24) |
| InChIKey | XSKCVYKACLBSON-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|