C35H31N3O7S — CID 122223809
N-[2-[4-(1,3-dioxoisoindol-2-yl)-3-oxobutyl]-5,6-dimethoxy-3-phenylindol-1-yl]-4-methylbenzenesulfonamide (PubChem CID 122223809) has the molecular formula C35H31N3O7S and a molecular weight of 637.71 g/mol. Its IUPAC name is N-[2-[4-(1,3-dioxoisoindol-2-yl)-3-oxobutyl]-5,6-dimethoxy-3-phenylindol-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)-3-oxobutyl]-5,6-dimethoxy-3-phenylindol-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122223809 |
| Molecular Formula | C35H31N3O7S |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)-3-oxobutyl]-5,6-dimethoxy-3-phenylindol-1-yl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc2c(-c3ccccc3)c(CCC(=O)CN3C(=O)c4ccccc4C3=O)n(NS(=O)(=O)c3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C35H31N3O7S/c1-22-13-16-25(17-14-22)46(42,43)36-38-29(18-15-24(39)21-37-34(40)26-11-7-8-12-27(26)35(37)41)33(23-9-5-4-6-10-23)28-19-31(44-2)32(45-3)20-30(28)38/h4-14,16-17,19-20,36H,15,18,21H2,1-3H3 |
| InChIKey | OZMODHJMOXYWNC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|