C20H20N2O5 — CID 54037639
2-[4-[4-(methoxymethoxymethyl)-2-pyridinyl]-2-oxobutyl]isoindole-1,3-dione (PubChem CID 54037639) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[4-[4-(methoxymethoxymethyl)-2-pyridinyl]-2-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(methoxymethoxymethyl)-2-pyridinyl]-2-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54037639 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[4-[4-(methoxymethoxymethyl)-2-pyridinyl]-2-oxobutyl]isoindole-1,3-dione |
| SMILES | COCOCc1ccnc(CCC(=O)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-26-13-27-12-14-8-9-21-15(10-14)6-7-16(23)11-22-19(24)17-4-2-3-5-18(17)20(22)25/h2-5,8-10H,6-7,11-13H2,1H3 |
| InChIKey | LKCJWBKPPSCTBG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|