About 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol
1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol (PubChem CID 122224274) has the molecular formula C18H22O5
and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol.
Molecular Properties
| Compound Name | 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol |
| PubChem CID | 122224274 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol |
| SMILES | [2H]C(O)(c1ccc(OC)c(OC)c1)C(C)Oc1ccccc1OC |
| InChI | InChI=1S/C18H22O5/c1-12(23-16-8-6-5-7-14(16)20-2)18(19)13-9-10-15(21-3)17(11-13)22-4/h5-12,18-19H,1-4H3/i18D |
| InChIKey | AHOFBNJIUMOJOW-VAAKKRCDSA-N |
| XLogP | 3.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol?
The IUPAC name of 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol (CID 122224274) is 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol.
What is the SMILES notation for 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol?
The canonical SMILES for 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol is [2H]C(O)(c1ccc(OC)c(OC)c1)C(C)Oc1ccccc1OC.
What is the InChIKey of 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol?
The InChIKey is AHOFBNJIUMOJOW-VAAKKRCDSA-N. The full InChI is InChI=1S/C18H22O5/c1-12(23-16-8-6-5-7-14(16)20-2)18(19)13-9-10-15(21-3)17(11-13)22-4/h5-12,18-19H,1-4H3/i18D.
What are the key properties of 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol?
1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol has a molecular weight of 319.38 g/mol, XLogP of 3.21, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-1-(3,4-dimethoxyphenyl)-2-(2-methoxyphenoxy)propan-1-ol is sourced from PubChem (CID 122224274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).