(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid

C6H10O6 — CID 122234456

IUPAC(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid
SMILESO=C(CO)C[C@H](O)[C@H](O)C(=O)O
InChIInChI=1S/C6H10O6/c7-2-3(8)1-4(9)5(10)6(11)12/h4-5,7,9-10H,1-2H2,(H,11,12)/t4-,5-/m0/s1
InChIKeyHYLXERCBYWMYGC-WHFBIAKZSA-N
MW178.14 g/mol
LogP-2.26
Rot. Bonds5

About (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid

(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid (PubChem CID 122234456) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid.

Molecular Properties

Compound Name(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid
PubChem CID122234456
Molecular FormulaC6H10O6
Molecular Weight178.14 g/mol
Exact Mass178.05
IUPAC Name(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid
SMILESO=C(CO)C[C@H](O)[C@H](O)C(=O)O
InChIInChI=1S/C6H10O6/c7-2-3(8)1-4(9)5(10)6(11)12/h4-5,7,9-10H,1-2H2,(H,11,12)/t4-,5-/m0/s1
InChIKeyHYLXERCBYWMYGC-WHFBIAKZSA-N
XLogP-2.26
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.14
LogP ≤ 5-2.26
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid?
The IUPAC name of (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid (CID 122234456) is (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid.
What is the SMILES notation for (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid?
The canonical SMILES for (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid is O=C(CO)C[C@H](O)[C@H](O)C(=O)O.
What is the InChIKey of (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid?
The InChIKey is HYLXERCBYWMYGC-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H10O6/c7-2-3(8)1-4(9)5(10)6(11)12/h4-5,7,9-10H,1-2H2,(H,11,12)/t4-,5-/m0/s1.
What are the key properties of (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid?
(2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid has a molecular weight of 178.14 g/mol, XLogP of -2.26, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3,6-trihydroxy-5-oxohexanoic acid is sourced from PubChem (CID 122234456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).