C17H23F3N2O2S2 — CID 122245367
1-(thian-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane (PubChem CID 122245367) has the molecular formula C17H23F3N2O2S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-(thian-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane.
| Compound Name | 1-(thian-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 122245367 |
| Molecular Formula | C17H23F3N2O2S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-(thian-4-yl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C17H23F3N2O2S2/c18-17(19,20)14-3-1-4-16(13-14)26(23,24)22-8-2-7-21(9-10-22)15-5-11-25-12-6-15/h1,3-4,13,15H,2,5-12H2 |
| InChIKey | JLQZCDMWWLSCSK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |