C30H41NO4Si — CID 122364543
(4S)-3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 122364543) has the molecular formula C30H41NO4Si and a molecular weight of 507.75 g/mol. Its IUPAC name is (4S)-3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 122364543 |
| Molecular Formula | C30H41NO4Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (4S)-3-[(E,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C/C(=C\[C@H](C)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C30H41NO4Si/c1-21(2)27-20-34-29(33)31(27)28(32)23(4)19-22(3)24(5)35-36(30(6,7)8,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-19,21-22,24,27H,20H2,1-8H3/b23-19+/t22-,24+,27+/m0/s1 |
| InChIKey | FJRGYFXSXLTMOJ-SXFOULJRSA-N |
| XLogP | 5.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|