C29H39NO5Si — CID 135023890
methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-[(2-oxo-1,3-oxazolidin-3-yl)methyl]hex-2-enoate (PubChem CID 135023890) has the molecular formula C29H39NO5Si and a molecular weight of 509.72 g/mol. Its IUPAC name is methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-[(2-oxo-1,3-oxazolidin-3-yl)methyl]hex-2-enoate.
| Compound Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-[(2-oxo-1,3-oxazolidin-3-yl)methyl]hex-2-enoate |
|---|---|
| PubChem CID | 135023890 |
| Molecular Formula | C29H39NO5Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-[(2-oxo-1,3-oxazolidin-3-yl)methyl]hex-2-enoate |
| SMILES | COC(=O)/C(=C/C(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CN1CCOC1=O |
| InChI | InChI=1S/C29H39NO5Si/c1-28(2,3)36(24-13-9-7-10-14-24,25-15-11-8-12-16-25)35-19-17-29(4,5)21-23(26(31)33-6)22-30-18-20-34-27(30)32/h7-16,21H,17-20,22H2,1-6H3/b23-21+ |
| InChIKey | UNAPMSUIDYVDHN-XTQSDGFTSA-N |
| XLogP | 4.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|