C26H33NO4Si — CID 12018407
3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 12018407) has the molecular formula C26H33NO4Si and a molecular weight of 451.64 g/mol. Its IUPAC name is 3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12018407 |
| Molecular Formula | C26H33NO4Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C/C=C/C(=O)N1CCOC1=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33NO4Si/c1-21(12-11-17-24(28)27-18-19-30-25(27)29)20-31-32(26(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-11,13-17,21H,12,18-20H2,1-4H3/b17-11+/t21-/m1/s1 |
| InChIKey | JCOXOXKLWQBJKO-KDHISYJLSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|