C26H33NO5Si — CID 177441848
methyl (Z)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-(2-oxo-1,3-oxazolidin-3-yl)pent-2-enoate (PubChem CID 177441848) has the molecular formula C26H33NO5Si and a molecular weight of 467.64 g/mol. Its IUPAC name is methyl (Z)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-(2-oxo-1,3-oxazolidin-3-yl)pent-2-enoate.
| Compound Name | methyl (Z)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-(2-oxo-1,3-oxazolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 177441848 |
| Molecular Formula | C26H33NO5Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | methyl (Z)-5-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-(2-oxo-1,3-oxazolidin-3-yl)pent-2-enoate |
| SMILES | COC(=O)/C(=C(\C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1CCOC1=O |
| InChI | InChI=1S/C26H33NO5Si/c1-20(23(24(28)30-5)27-17-19-31-25(27)29)16-18-32-33(26(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15H,16-19H2,1-5H3/b23-20- |
| InChIKey | XYBSMPGADBRVTJ-ATJXCDBQSA-N |
| XLogP | 3.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|