C17H10F3NO2 — CID 122368460
methyl 2-(3,5-difluorophenyl)-7-fluoroquinoline-3-carboxylate (PubChem CID 122368460) has the molecular formula C17H10F3NO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is methyl 2-(3,5-difluorophenyl)-7-fluoroquinoline-3-carboxylate.
| Compound Name | methyl 2-(3,5-difluorophenyl)-7-fluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 122368460 |
| Molecular Formula | C17H10F3NO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | methyl 2-(3,5-difluorophenyl)-7-fluoroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2ccc(F)cc2nc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H10F3NO2/c1-23-17(22)14-6-9-2-3-11(18)8-15(9)21-16(14)10-4-12(19)7-13(20)5-10/h2-8H,1H3 |
| InChIKey | GDKWXYJUEMXVTJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |