C19H16ClNO5 — CID 122376450
dimethyl 2-(4-chlorophenyl)-4-phenyl-2H-1,3-oxazole-5,5-dicarboxylate (PubChem CID 122376450) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is dimethyl 2-(4-chlorophenyl)-4-phenyl-2H-1,3-oxazole-5,5-dicarboxylate.
| Compound Name | dimethyl 2-(4-chlorophenyl)-4-phenyl-2H-1,3-oxazole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 122376450 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | dimethyl 2-(4-chlorophenyl)-4-phenyl-2H-1,3-oxazole-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)OC(c2ccc(Cl)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C19H16ClNO5/c1-24-17(22)19(18(23)25-2)15(12-6-4-3-5-7-12)21-16(26-19)13-8-10-14(20)11-9-13/h3-11,16H,1-2H3 |
| InChIKey | MKWJNTNVIVZJEF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|