C19H14ClNO2 — CID 122388161
3-[(Z)-1-(3-chlorophenyl)-4-phenylbut-1-en-3-yn-2-yl]-1,3-oxazolidin-2-one (PubChem CID 122388161) has the molecular formula C19H14ClNO2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 3-[(Z)-1-(3-chlorophenyl)-4-phenylbut-1-en-3-yn-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-1-(3-chlorophenyl)-4-phenylbut-1-en-3-yn-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 122388161 |
| Molecular Formula | C19H14ClNO2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-[(Z)-1-(3-chlorophenyl)-4-phenylbut-1-en-3-yn-2-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C(C#Cc1ccccc1)=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClNO2/c20-17-8-4-7-16(13-17)14-18(21-11-12-23-19(21)22)10-9-15-5-2-1-3-6-15/h1-8,13-14H,11-12H2/b18-14- |
| InChIKey | HHDSMRMLQVWVQN-JXAWBTAJSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|