C25H19NO2 — CID 122388165
(4R)-3-[(Z)-1,4-diphenylbut-1-en-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 122388165) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is (4R)-3-[(Z)-1,4-diphenylbut-1-en-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z)-1,4-diphenylbut-1-en-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 122388165 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (4R)-3-[(Z)-1,4-diphenylbut-1-en-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1/C(C#Cc1ccccc1)=C\c1ccccc1 |
| InChI | InChI=1S/C25H19NO2/c27-25-26(24(19-28-25)22-14-8-3-9-15-22)23(18-21-12-6-2-7-13-21)17-16-20-10-4-1-5-11-20/h1-15,18,24H,19H2/b23-18-/t24-/m0/s1 |
| InChIKey | SNLLJYSFRXGRBS-CVMULMBHSA-N |
| XLogP | 5.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|