C25H34O11S — CID 122389492
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-tert-butylphenyl)methylsulfonyl]oxan-2-yl]methyl acetate (PubChem CID 122389492) has the molecular formula C25H34O11S and a molecular weight of 542.60 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-tert-butylphenyl)methylsulfonyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-tert-butylphenyl)methylsulfonyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122389492 |
| Molecular Formula | C25H34O11S |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-tert-butylphenyl)methylsulfonyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](S(=O)(=O)Cc2ccc(C(C)(C)C)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O11S/c1-14(26)32-12-20-21(33-15(2)27)22(34-16(3)28)23(35-17(4)29)24(36-20)37(30,31)13-18-8-10-19(11-9-18)25(5,6)7/h8-11,20-24H,12-13H2,1-7H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | TYXOZGRQKPYPTD-URYYLNOGSA-N |
| XLogP | 1.98 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|