About Se-(4-nitrophenyl) carbamoselenoate
Se-(4-nitrophenyl) carbamoselenoate (PubChem CID 122395813) has the molecular formula C7H6N2O3Se
and a molecular weight of 245.10 g/mol. Its IUPAC name is Se-(4-nitrophenyl) carbamoselenoate.
Molecular Properties
| Compound Name | Se-(4-nitrophenyl) carbamoselenoate |
| PubChem CID | 122395813 |
| Molecular Formula | C7H6N2O3Se |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | Se-(4-nitrophenyl) carbamoselenoate |
| SMILES | NC(=O)[Se]c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H6N2O3Se/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | PWJXQQZFOQVOKR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Se-(4-nitrophenyl) carbamoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-(4-nitrophenyl) carbamoselenoate?
The IUPAC name of Se-(4-nitrophenyl) carbamoselenoate (CID 122395813) is Se-(4-nitrophenyl) carbamoselenoate.
What is the SMILES notation for Se-(4-nitrophenyl) carbamoselenoate?
The canonical SMILES for Se-(4-nitrophenyl) carbamoselenoate is NC(=O)[Se]c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of Se-(4-nitrophenyl) carbamoselenoate?
The InChIKey is PWJXQQZFOQVOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3Se/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H,(H2,8,10).
What are the key properties of Se-(4-nitrophenyl) carbamoselenoate?
Se-(4-nitrophenyl) carbamoselenoate has a molecular weight of 245.10 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Se-(4-nitrophenyl) carbamoselenoate is sourced from PubChem (CID 122395813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).