C35H56N2O4Si2 — CID 122400203
tert-butyl N-[(1R,2R)-1-(1-benzylindol-3-yl)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]carbamate (PubChem CID 122400203) has the molecular formula C35H56N2O4Si2 and a molecular weight of 625.02 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(1-benzylindol-3-yl)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(1-benzylindol-3-yl)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 122400203 |
| Molecular Formula | C35H56N2O4Si2 |
| Molecular Weight | 625.02 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(1-benzylindol-3-yl)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C35H56N2O4Si2/c1-33(2,3)40-32(38)36-29(25-39-42(10,11)34(4,5)6)31(41-43(12,13)35(7,8)9)28-24-37(23-26-19-15-14-16-20-26)30-22-18-17-21-27(28)30/h14-22,24,29,31H,23,25H2,1-13H3,(H,36,38)/t29-,31-/m1/s1 |
| InChIKey | VCIHRPNIKPAXKL-BVRKHOPBSA-N |
| XLogP | 9.67 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.02 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|