C26H40N2O4Si — CID 138969607
prop-2-enyl N-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propan-2-yl]carbamate (PubChem CID 138969607) has the molecular formula C26H40N2O4Si and a molecular weight of 472.70 g/mol. Its IUPAC name is prop-2-enyl N-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 138969607 |
| Molecular Formula | C26H40N2O4Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | prop-2-enyl N-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propan-2-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)c1cn(C(C)(C)C=C)c2ccccc12 |
| InChI | InChI=1S/C26H40N2O4Si/c1-10-16-31-24(30)27-21(18-29)23(32-33(8,9)25(3,4)5)20-17-28(26(6,7)11-2)22-15-13-12-14-19(20)22/h10-15,17,21,23,29H,1-2,16,18H2,3-9H3,(H,27,30)/t21-,23-/m1/s1 |
| InChIKey | CTZVSOYIIYTTOS-FYYLOGMGSA-N |
| XLogP | 5.90 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|