C10H10N2O3 — CID 122401579
(2S)-2-amino-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetic acid (PubChem CID 122401579) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S)-2-amino-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetic acid.
| Compound Name | (2S)-2-amino-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 122401579 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2S)-2-amino-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetic acid |
| SMILES | N[C@H](C(=O)O)[C@H]1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H10N2O3/c11-7(10(14)15)8-5-3-1-2-4-6(5)9(13)12-8/h1-4,7-8H,11H2,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | RRPOJKLCOUMMLJ-YUMQZZPRSA-N |
| XLogP | -0.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |