C25H27N5O3 — CID 122422261
1-[4-[[2-(3-acetylphenyl)-4-amino-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 122422261) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[4-[[2-(3-acetylphenyl)-4-amino-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[2-(3-acetylphenyl)-4-amino-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122422261 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-[[2-(3-acetylphenyl)-4-amino-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc3c(N)nc(-c4cccc(C(C)=O)c4)nc3cc2OC)CC1 |
| InChI | InChI=1S/C25H27N5O3/c1-4-23(32)30-10-8-18(9-11-30)27-21-13-19-20(14-22(21)33-3)28-25(29-24(19)26)17-7-5-6-16(12-17)15(2)31/h4-7,12-14,18,27H,1,8-11H2,2-3H3,(H2,26,28,29) |
| InChIKey | KINUWYOMYLTOJG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|