C9H9NS — CID 122429670
4-thiophen-3-yl-2,5-dihydropyridine (PubChem CID 122429670) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is 4-thiophen-3-yl-2,5-dihydropyridine.
| Compound Name | 4-thiophen-3-yl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 122429670 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 4-thiophen-3-yl-2,5-dihydropyridine |
| SMILES | C1=NCC=C(c2ccsc2)C1 |
| InChI | InChI=1S/C9H9NS/c1-4-10-5-2-8(1)9-3-6-11-7-9/h1,3,5-7H,2,4H2 |
| InChIKey | LZVIGPOAGZFQPV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |