C40H30N2 — CID 122431199
4-[3-[4-(1,2-dihydropyridin-6-yl)phenyl]-5-phenylphenyl]-2,6-diphenylpyridine (PubChem CID 122431199) has the molecular formula C40H30N2 and a molecular weight of 538.69 g/mol. Its IUPAC name is 4-[3-[4-(1,2-dihydropyridin-6-yl)phenyl]-5-phenylphenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3-[4-(1,2-dihydropyridin-6-yl)phenyl]-5-phenylphenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 122431199 |
| Molecular Formula | C40H30N2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 4-[3-[4-(1,2-dihydropyridin-6-yl)phenyl]-5-phenylphenyl]-2,6-diphenylpyridine |
| SMILES | C1=CCNC(c2ccc(-c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)c3)cc2)=C1 |
| InChI | InChI=1S/C40H30N2/c1-4-12-29(13-5-1)34-24-35(30-19-21-33(22-20-30)38-18-10-11-23-41-38)26-36(25-34)37-27-39(31-14-6-2-7-15-31)42-40(28-37)32-16-8-3-9-17-32/h1-22,24-28,41H,23H2 |
| InChIKey | OTZXERMINMLITG-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |