C52H60N4O4S — CID 122434108
[2-[[4-[bis[4-(2,6-dimethylanilino)phenyl]methyl]-6-(methylsulfamoyl)naphthalen-1-yl]amino]cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 122434108) has the molecular formula C52H60N4O4S and a molecular weight of 837.14 g/mol. Its IUPAC name is [2-[[4-[bis[4-(2,6-dimethylanilino)phenyl]methyl]-6-(methylsulfamoyl)naphthalen-1-yl]amino]cyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[[4-[bis[4-(2,6-dimethylanilino)phenyl]methyl]-6-(methylsulfamoyl)naphthalen-1-yl]amino]cyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122434108 |
| Molecular Formula | C52H60N4O4S |
| Molecular Weight | 837.14 g/mol |
| Exact Mass | 836.43 |
| IUPAC Name | [2-[[4-[bis[4-(2,6-dimethylanilino)phenyl]methyl]-6-(methylsulfamoyl)naphthalen-1-yl]amino]cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCCCC1Nc1ccc(C(c2ccc(Nc3c(C)cccc3C)cc2)c2ccc(Nc3c(C)cccc3C)cc2)c2cc(S(=O)(=O)NC)ccc12 |
| InChI | InChI=1S/C52H60N4O4S/c1-9-52(6,7)51(57)60-47-19-11-10-18-46(47)56-45-31-30-43(44-32-41(28-29-42(44)45)61(58,59)53-8)48(37-20-24-39(25-21-37)54-49-33(2)14-12-15-34(49)3)38-22-26-40(27-23-38)55-50-35(4)16-13-17-36(50)5/h12-17,20-32,46-48,53-56H,9-11,18-19H2,1-8H3 |
| InChIKey | PRBZPMMVXCAZHY-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.14 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|