C23H38N2O9 — CID 122451529
N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-8-(1-hydroxybutan-2-yloxy)-8-methoxy-5-oxooctanamide (PubChem CID 122451529) has the molecular formula C23H38N2O9 and a molecular weight of 486.56 g/mol. Its IUPAC name is N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-8-(1-hydroxybutan-2-yloxy)-8-methoxy-5-oxooctanamide.
| Compound Name | N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-8-(1-hydroxybutan-2-yloxy)-8-methoxy-5-oxooctanamide |
|---|---|
| PubChem CID | 122451529 |
| Molecular Formula | C23H38N2O9 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-8-(1-hydroxybutan-2-yloxy)-8-methoxy-5-oxooctanamide |
| SMILES | CCC(CO)OC(CCC(=O)CCCC(=O)NCCOCCOCCN1C(=O)C=CC1=O)OC |
| InChI | InChI=1S/C23H38N2O9/c1-3-19(17-26)34-23(31-2)10-7-18(27)5-4-6-20(28)24-11-13-32-15-16-33-14-12-25-21(29)8-9-22(25)30/h8-9,19,23,26H,3-7,10-17H2,1-2H3,(H,24,28) |
| InChIKey | UOUPPUAHTHYHOW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|