C25H33F4N7 — CID 122461418
1-cyclopentyl-1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]guanidine (PubChem CID 122461418) has the molecular formula C25H33F4N7 and a molecular weight of 507.58 g/mol. Its IUPAC name is 1-cyclopentyl-1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-cyclopentyl-1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 122461418 |
| Molecular Formula | C25H33F4N7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 1-cyclopentyl-1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]guanidine |
| SMILES | CCN1CCCC(Nc2cc(C)nc(N(/C(N)=N/c3ccc(F)c(C(F)(F)F)c3)C3CCCC3)n2)C1 |
| InChI | InChI=1S/C25H33F4N7/c1-3-35-12-6-7-18(15-35)32-22-13-16(2)31-24(34-22)36(19-8-4-5-9-19)23(30)33-17-10-11-21(26)20(14-17)25(27,28)29/h10-11,13-14,18-19H,3-9,12,15H2,1-2H3,(H2,30,33)(H,31,32,34) |
| InChIKey | DPTHOHIMYMHFBD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|