C24H34ClN7 — CID 154410000
1-(4-chlorophenyl)-1-cyclopentyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]guanidine (PubChem CID 154410000) has the molecular formula C24H34ClN7 and a molecular weight of 456.04 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-cyclopentyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]guanidine.
| Compound Name | 1-(4-chlorophenyl)-1-cyclopentyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 154410000 |
| Molecular Formula | C24H34ClN7 |
| Molecular Weight | 456.04 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-(4-chlorophenyl)-1-cyclopentyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]guanidine |
| SMILES | CCN1CCCC(Nc2cc(C)nc(N=C(N)N(c3ccc(Cl)cc3)C3CCCC3)n2)C1 |
| InChI | InChI=1S/C24H34ClN7/c1-3-31-14-6-7-19(16-31)28-22-15-17(2)27-24(29-22)30-23(26)32(20-8-4-5-9-20)21-12-10-18(25)11-13-21/h10-13,15,19-20H,3-9,14,16H2,1-2H3,(H3,26,27,28,29,30) |
| InChIKey | NMHPKPPQNLVZNA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|