C22H30FN7 — CID 154409996
1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-(4-fluorophenyl)guanidine (PubChem CID 154409996) has the molecular formula C22H30FN7 and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-(4-fluorophenyl)guanidine.
| Compound Name | 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-(4-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 154409996 |
| Molecular Formula | C22H30FN7 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-(4-fluorophenyl)guanidine |
| SMILES | CCN1CCCC(Nc2cc(C)nc(N=C(N)N(c3ccc(F)cc3)C3CC3)n2)C1 |
| InChI | InChI=1S/C22H30FN7/c1-3-29-12-4-5-17(14-29)26-20-13-15(2)25-22(27-20)28-21(24)30(19-10-11-19)18-8-6-16(23)7-9-18/h6-9,13,17,19H,3-5,10-12,14H2,1-2H3,(H3,24,25,26,27,28) |
| InChIKey | FFSRMFFNMQUZTJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|