C21H28F3N7O — CID 140734594
2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-methyl-1-[3-(trifluoromethoxy)phenyl]guanidine (PubChem CID 140734594) has the molecular formula C21H28F3N7O and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-methyl-1-[3-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-methyl-1-[3-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 140734594 |
| Molecular Formula | C21H28F3N7O |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-methyl-1-[3-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CCN1CCCC(Nc2cc(C)nc(/N=C(/N)N(C)c3cccc(OC(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C21H28F3N7O/c1-4-31-10-6-7-15(13-31)27-18-11-14(2)26-20(28-18)29-19(25)30(3)16-8-5-9-17(12-16)32-21(22,23)24/h5,8-9,11-12,15H,4,6-7,10,13H2,1-3H3,(H3,25,26,27,28,29) |
| InChIKey | VVAABOFLPJCVDG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|