C20H28ClN7 — CID 154410048
1-(4-chlorophenyl)-2-[4-[(1-ethylpyrrolidin-3-yl)-methylamino]-6-methylpyrimidin-2-yl]-1-methylguanidine (PubChem CID 154410048) has the molecular formula C20H28ClN7 and a molecular weight of 401.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-[(1-ethylpyrrolidin-3-yl)-methylamino]-6-methylpyrimidin-2-yl]-1-methylguanidine.
| Compound Name | 1-(4-chlorophenyl)-2-[4-[(1-ethylpyrrolidin-3-yl)-methylamino]-6-methylpyrimidin-2-yl]-1-methylguanidine |
|---|---|
| PubChem CID | 154410048 |
| Molecular Formula | C20H28ClN7 |
| Molecular Weight | 401.95 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-[(1-ethylpyrrolidin-3-yl)-methylamino]-6-methylpyrimidin-2-yl]-1-methylguanidine |
| SMILES | CCN1CCC(N(C)c2cc(C)nc(N=C(N)N(C)c3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C20H28ClN7/c1-5-28-11-10-17(13-28)26(3)18-12-14(2)23-20(24-18)25-19(22)27(4)16-8-6-15(21)7-9-16/h6-9,12,17H,5,10-11,13H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | QSAOEDOFDSCCPC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.95 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|