C23H30F3N7O — CID 154409994
1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 154409994) has the molecular formula C23H30F3N7O and a molecular weight of 477.54 g/mol. Its IUPAC name is 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 154409994 |
| Molecular Formula | C23H30F3N7O |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-cyclopropyl-2-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CCN1CCCC(Nc2cc(C)nc(N=C(N)N(c3ccc(OC(F)(F)F)cc3)C3CC3)n2)C1 |
| InChI | InChI=1S/C23H30F3N7O/c1-3-32-12-4-5-16(14-32)29-20-13-15(2)28-22(30-20)31-21(27)33(17-6-7-17)18-8-10-19(11-9-18)34-23(24,25)26/h8-11,13,16-17H,3-7,12,14H2,1-2H3,(H3,27,28,29,30,31) |
| InChIKey | VFLHFPBRVWGIQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|