C16H16F3N5 — CID 122479017
5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-2H-triazole-4-carbonitrile (PubChem CID 122479017) has the molecular formula C16H16F3N5 and a molecular weight of 335.33 g/mol. Its IUPAC name is 5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479017 |
| Molecular Formula | C16H16F3N5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1C1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H16F3N5/c17-16(18,19)13-3-1-2-11(8-13)10-24-6-4-12(5-7-24)15-14(9-20)21-23-22-15/h1-3,8,12H,4-7,10H2,(H,21,22,23) |
| InChIKey | NCNNABSCOIFRIW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |