C40H49N — CID 122484986
N-[1-[4-[2-(2,4-dipropylphenyl)-2-phenylethenyl]phenyl]propyl]-2,6-dimethyl-4-propylaniline (PubChem CID 122484986) has the molecular formula C40H49N and a molecular weight of 543.84 g/mol. Its IUPAC name is N-[1-[4-[2-(2,4-dipropylphenyl)-2-phenylethenyl]phenyl]propyl]-2,6-dimethyl-4-propylaniline.
| Compound Name | N-[1-[4-[2-(2,4-dipropylphenyl)-2-phenylethenyl]phenyl]propyl]-2,6-dimethyl-4-propylaniline |
|---|---|
| PubChem CID | 122484986 |
| Molecular Formula | C40H49N |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | N-[1-[4-[2-(2,4-dipropylphenyl)-2-phenylethenyl]phenyl]propyl]-2,6-dimethyl-4-propylaniline |
| SMILES | CCCc1cc(C)c(NC(CC)c2ccc(C=C(c3ccccc3)c3ccc(CCC)cc3CCC)cc2)c(C)c1 |
| InChI | InChI=1S/C40H49N/c1-7-14-31-21-24-37(36(27-31)16-9-3)38(34-17-12-11-13-18-34)28-32-19-22-35(23-20-32)39(10-4)41-40-29(5)25-33(15-8-2)26-30(40)6/h11-13,17-28,39,41H,7-10,14-16H2,1-6H3 |
| InChIKey | OWZOFDNADBVVSN-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|