C25H35N7O4S2 — CID 122500242
tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]-methylamino]-1,2,2-trimethylcyclopentyl]carbamate (PubChem CID 122500242) has the molecular formula C25H35N7O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]-methylamino]-1,2,2-trimethylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]-methylamino]-1,2,2-trimethylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 122500242 |
| Molecular Formula | C25H35N7O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]-methylamino]-1,2,2-trimethylcyclopentyl]carbamate |
| SMILES | CN(c1c(C(N)=O)cnn2cc(-c3nnc(S(C)=O)s3)cc12)[C@@H]1CC[C@](C)(NC(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C25H35N7O4S2/c1-23(2,3)36-21(34)28-25(6)10-9-17(24(25,4)5)31(7)18-15(19(26)33)12-27-32-13-14(11-16(18)32)20-29-30-22(37-20)38(8)35/h11-13,17H,9-10H2,1-8H3,(H2,26,33)(H,28,34)/t17-,25+,38?/m1/s1 |
| InChIKey | UPXNDKOMBLKTRF-WJYOKYGRSA-N |
| XLogP | 3.60 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |