C17H23ClN2O4 — CID 122501479
tert-butyl N-[8-chloro-4-methyl-6-(2-methyloxiran-2-yl)-2,3-dihydropyrano[2,3-c]pyridin-4-yl]carbamate (PubChem CID 122501479) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is tert-butyl N-[8-chloro-4-methyl-6-(2-methyloxiran-2-yl)-2,3-dihydropyrano[2,3-c]pyridin-4-yl]carbamate.
| Compound Name | tert-butyl N-[8-chloro-4-methyl-6-(2-methyloxiran-2-yl)-2,3-dihydropyrano[2,3-c]pyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 122501479 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | tert-butyl N-[8-chloro-4-methyl-6-(2-methyloxiran-2-yl)-2,3-dihydropyrano[2,3-c]pyridin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C)CCOc2c1cc(C1(C)CO1)nc2Cl |
| InChI | InChI=1S/C17H23ClN2O4/c1-15(2,3)24-14(21)20-16(4)6-7-22-12-10(16)8-11(19-13(12)18)17(5)9-23-17/h8H,6-7,9H2,1-5H3,(H,20,21) |
| InChIKey | YNKVVQBIVDPUIO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|