C32H42F4O3 — CID 122503877
2-[2-[4-[(E)-2-(4-butoxycyclohexyl)ethenyl]cyclohexyl]ethynyl]-5-[(3,5-difluorophenoxy)-difluoromethyl]oxane (PubChem CID 122503877) has the molecular formula C32H42F4O3 and a molecular weight of 550.68 g/mol. Its IUPAC name is 2-[2-[4-[(E)-2-(4-butoxycyclohexyl)ethenyl]cyclohexyl]ethynyl]-5-[(3,5-difluorophenoxy)-difluoromethyl]oxane.
| Compound Name | 2-[2-[4-[(E)-2-(4-butoxycyclohexyl)ethenyl]cyclohexyl]ethynyl]-5-[(3,5-difluorophenoxy)-difluoromethyl]oxane |
|---|---|
| PubChem CID | 122503877 |
| Molecular Formula | C32H42F4O3 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 2-[2-[4-[(E)-2-(4-butoxycyclohexyl)ethenyl]cyclohexyl]ethynyl]-5-[(3,5-difluorophenoxy)-difluoromethyl]oxane |
| SMILES | CCCCOC1CCC(/C=C/C2CCC(C#CC3CCC(C(F)(F)Oc4cc(F)cc(F)c4)CO3)CC2)CC1 |
| InChI | InChI=1S/C32H42F4O3/c1-2-3-18-37-29-14-10-25(11-15-29)9-6-23-4-7-24(8-5-23)12-16-30-17-13-26(22-38-30)32(35,36)39-31-20-27(33)19-28(34)21-31/h6,9,19-21,23-26,29-30H,2-5,7-8,10-11,13-15,17-18,22H2,1H3/b9-6+ |
| InChIKey | IESJAHXOCJSOCG-RMKNXTFCSA-N |
| XLogP | 8.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|