C28H40O10 — CID 122545148
[(2R)-3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-11-(2-hydroxyethyl)-1-methoxy-4-phenylmethoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-methylpropyl] acetate (PubChem CID 122545148) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is [(2R)-3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-11-(2-hydroxyethyl)-1-methoxy-4-phenylmethoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-methylpropyl] acetate.
| Compound Name | [(2R)-3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-11-(2-hydroxyethyl)-1-methoxy-4-phenylmethoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 122545148 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [(2R)-3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-11-(2-hydroxyethyl)-1-methoxy-4-phenylmethoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-methylpropyl] acetate |
| SMILES | COC12CC[C@H](CCO)O[C@@H]1[C@@H](OC(C)=O)[C@@H]1O[C@H](C[C@@H](C)COC(C)=O)[C@H](OCc3ccccc3)[C@@H]1O2 |
| InChI | InChI=1S/C28H40O10/c1-17(15-33-18(2)30)14-22-23(34-16-20-8-6-5-7-9-20)25-24(37-22)26(35-19(3)31)27-28(32-4,38-25)12-10-21(36-27)11-13-29/h5-9,17,21-27,29H,10-16H2,1-4H3/t17-,21-,22-,23+,24-,25+,26+,27-,28?/m1/s1 |
| InChIKey | VMOTVAHJZWTRBC-GJDUOTTJSA-N |
| XLogP | 2.53 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |