C24H40O11 — CID 122546461
[3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-4-butoxy-11-(2-hydroxyethyl)-1-methoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-hydroxypropyl] acetate (PubChem CID 122546461) has the molecular formula C24H40O11 and a molecular weight of 504.57 g/mol. Its IUPAC name is [3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-4-butoxy-11-(2-hydroxyethyl)-1-methoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-hydroxypropyl] acetate.
| Compound Name | [3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-4-butoxy-11-(2-hydroxyethyl)-1-methoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-hydroxypropyl] acetate |
|---|---|
| PubChem CID | 122546461 |
| Molecular Formula | C24H40O11 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [3-[(3S,4S,5R,7R,8S,9R,11R)-8-acetyloxy-4-butoxy-11-(2-hydroxyethyl)-1-methoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-2-hydroxypropyl] acetate |
| SMILES | CCCCO[C@@H]1[C@@H]2OC3(OC)CC[C@H](CCO)O[C@@H]3[C@@H](OC(C)=O)[C@@H]2O[C@@H]1CC(O)COC(C)=O |
| InChI | InChI=1S/C24H40O11/c1-5-6-11-30-19-18(12-16(28)13-31-14(2)26)34-20-21(19)35-24(29-4)9-7-17(8-10-25)33-23(24)22(20)32-15(3)27/h16-23,25,28H,5-13H2,1-4H3/t16?,17-,18-,19+,20-,21+,22+,23-,24?/m1/s1 |
| InChIKey | OOBZYQVZNXWDIS-AXBBNJDXSA-N |
| XLogP | 0.86 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|